CAS 223137-76-6 is the registry number for 4,4'-Dibromo-7,7'-dimethoxy-2,2',3,3'-tetrahydro-1,1'-spirobi[indene], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,7'-dibromo-4,4'-dimethoxy-3,3'-spirobi[1,2-dihydroindene] (CAS 223137-76-6) is a chemical compound with the molecular formula C19H18Br2O2 and a molecular weight of 438.2 g/mol. IUPAC name: 7,7'-dibromo-4,4'-dimethoxy-3,3'-spirobi[1,2-dihydroindene]. InChIKey: CXSHFZOCKAZZTM-UHFFFAOYSA-N.
| Molecular formula | C19H18Br2O2 |
|---|---|
| Molecular weight | 438.2 g/mol |
| IUPAC name | 7,7'-dibromo-4,4'-dimethoxy-3,3'-spirobi[1,2-dihydroindene] |
| InChIKey | CXSHFZOCKAZZTM-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Br)CCC23CCC4=C(C=CC(=C34)OC)Br |
Computed by PubChem (NCBI)