CAS 35333-27-8 is the registry number for 1,7-Bis(4-bromophenyl)heptane-1,7-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,7-bis(4-bromophenyl)heptane-1,7-dione (CAS 35333-27-8) is a chemical compound with the molecular formula C19H18Br2O2 and a molecular weight of 438.2 g/mol. IUPAC name: 1,7-bis(4-bromophenyl)heptane-1,7-dione. InChIKey: GXLQICGAZPPGJN-UHFFFAOYSA-N.
| Molecular formula | C19H18Br2O2 |
|---|---|
| Molecular weight | 438.2 g/mol |
| IUPAC name | 1,7-bis(4-bromophenyl)heptane-1,7-dione |
| InChIKey | GXLQICGAZPPGJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCCCCC(=O)C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)