Products 2231665-97-5

CAS 2231665-97-5 is the registry number for Methyl cis-3-amino-1-fluorocyclobutane-1-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-1-fluorocyclobutane-1-carboxylate;hydrochloride (CAS 2231665-97-5) is a chemical compound with the molecular formula C6H11ClFNO2 and a molecular weight of 183.61 g/mol. IUPAC name: methyl 3-amino-1-fluorocyclobutane-1-carboxylate;hydrochloride. InChIKey: MPTPEAOONJIDPF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClFNO2
Molecular weight183.61 g/mol
IUPAC namemethyl 3-amino-1-fluorocyclobutane-1-carboxylate;hydrochloride
InChIKeyMPTPEAOONJIDPF-UHFFFAOYSA-N
SMILESCOC(=O)C1(CC(C1)N)F.Cl

Computed by PubChem (NCBI)