CAS 2679768-21-7 is the registry number for (1R,3S,4S)-3-Amino-4-fluorocyclopentane-1-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,3S,4S)-3-amino-4-fluorocyclopentane-1-carboxylic acid;hydrochloride (CAS 2679768-21-7) is a chemical compound with the molecular formula C6H11ClFNO2 and a molecular weight of 183.61 g/mol. IUPAC name: (1R,3S,4S)-3-amino-4-fluorocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: NOPZHHQNNRZLMB-SHLRHQAISA-N.
| Molecular formula | C6H11ClFNO2 |
|---|---|
| Molecular weight | 183.61 g/mol |
| IUPAC name | (1R,3S,4S)-3-amino-4-fluorocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | NOPZHHQNNRZLMB-SHLRHQAISA-N |
| SMILES | C1[C@H](C[C@@H]([C@H]1N)F)C(=O)O.Cl |
Computed by PubChem (NCBI)