CAS 2231770-85-5 is the registry number for (1S,5R)-1-(2-Chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 2231770-85-5) is a chemical compound with the molecular formula C11H12Cl2FN and a molecular weight of 248.12 g/mol. IUPAC name: (1S,5R)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: WBDMTRSLHJXGSI-WJRQTEJMSA-N.
| Molecular formula | C11H12Cl2FN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | (1S,5R)-1-(2-chloro-4-fluorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | WBDMTRSLHJXGSI-WJRQTEJMSA-N |
| SMILES | C1[C@@H]2[C@]1(CNC2)C3=C(C=C(C=C3)F)Cl.Cl |
Computed by PubChem (NCBI)