CAS 2305251-79-8 is the registry number for 4-(3-Chloro-2-fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3-chloro-2-fluorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride (CAS 2305251-79-8) is a chemical compound with the molecular formula C11H12Cl2FN and a molecular weight of 248.12 g/mol. IUPAC name: 4-(3-chloro-2-fluorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride. InChIKey: FIIUVADPPOGMTG-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2FN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 4-(3-chloro-2-fluorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride |
| InChIKey | FIIUVADPPOGMTG-UHFFFAOYSA-N |
| SMILES | C1CNCC=C1C2=C(C(=CC=C2)Cl)F.Cl |
Computed by PubChem (NCBI)