Products 223267-77-4
CAS 223267-77-4 is the registry number for 9-(Diethylamino)-5-(ethylamino)benzo(a)phenoxazin-7-ium Perchlorate. Offered by: TRC. Available pack sizes: 1g.
Diethyl-[5-(ethylamino)benzo[a]phenoxazin-9-ylidene]azanium perchlorate (CAS 223267-77-4) is a chemical compound with the molecular formula C22H24ClN3O5 and a molecular weight of 445.9 g/mol. IUPAC name: diethyl-[5-(ethylamino)benzo[a]phenoxazin-9-ylidene]azanium perchlorate. InChIKey: NYOFDZRNZHQZDN-UHFFFAOYSA-N.
| Molecular formula | C22H24ClN3O5 |
|---|---|
| Molecular weight | 445.9 g/mol |
| IUPAC name | diethyl-[5-(ethylamino)benzo[a]phenoxazin-9-ylidene]azanium perchlorate |
| InChIKey | NYOFDZRNZHQZDN-UHFFFAOYSA-N |
| SMILES | CCNC1=CC2=C(C3=CC=CC=C31)N=C4C=CC(=[N+](CC)CC)C=C4O2.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)