CAS 27833-64-3 appears in our catalog under these names: Loxapine succinate salt, 95%, Loxapine, Succinate, >95% (HPLC), Loxapine Succinate, >95% (HPLC), Loxapine Succinate, Loxapine.succinate. Offered by: Combi-blocks, TRC, Mikromol, LoGiCal, Lipomed. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 50mg, 10mg, 1ml.
Butanedioic acid;8-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (CAS 27833-64-3) is a chemical compound with the molecular formula C22H24ClN3O5 and a molecular weight of 445.9 g/mol. IUPAC name: butanedioic acid;8-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine. InChIKey: YQZBAXDVDZTKEQ-UHFFFAOYSA-N.
| Molecular formula | C22H24ClN3O5 |
|---|---|
| Molecular weight | 445.9 g/mol |
| IUPAC name | butanedioic acid;8-chloro-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| InChIKey | YQZBAXDVDZTKEQ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl.C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)