Products 223412-29-1
CAS 223412-29-1 is the registry number for Octyl D-galactofuranoside tetraacetate. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
[(2S)-2-acetyloxy-2-[(2S,3S,4R)-3,4-diacetyloxy-5-octoxyoxolan-2-yl]ethyl] acetate (CAS 223412-29-1) is a chemical compound with the molecular formula C22H36O10 and a molecular weight of 460.5 g/mol. IUPAC name: [(2S)-2-acetyloxy-2-[(2S,3S,4R)-3,4-diacetyloxy-5-octoxyoxolan-2-yl]ethyl] acetate. InChIKey: YQYGIWWSRQRBBQ-CJLFMRGVSA-N.
| Molecular formula | C22H36O10 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | [(2S)-2-acetyloxy-2-[(2S,3S,4R)-3,4-diacetyloxy-5-octoxyoxolan-2-yl]ethyl] acetate |
| InChIKey | YQYGIWWSRQRBBQ-CJLFMRGVSA-N |
| SMILES | CCCCCCCCOC1[C@@H]([C@H]([C@@H](O1)[C@H](COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)