Products 86448-98-8
CAS 86448-98-8 is the registry number for 2,3,4-Tri-O-pivaloyl-β-D-glucopyranuronic acid methyl ester. Offered by: Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
Methyl (2S,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-hydroxyoxane-2-carboxylate (CAS 86448-98-8) is a chemical compound with the molecular formula C22H36O10 and a molecular weight of 460.5 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-hydroxyoxane-2-carboxylate. InChIKey: NYTBUPOBOYQQEM-GRYWWWGRSA-N.
| Molecular formula | C22H36O10 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-hydroxyoxane-2-carboxylate |
| InChIKey | NYTBUPOBOYQQEM-GRYWWWGRSA-N |
| SMILES | CC(C)(C)C(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C(C)(C)C)O)C(=O)OC)OC(=O)C(C)(C)C |
Computed by PubChem (NCBI)