CAS 2234308-25-7 is the registry number for Rubber Oligomer 8. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,4,6,6-tetramethylcyclohexene-1-carboxylate (CAS 2234308-25-7) is a chemical compound with the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. IUPAC name: methyl 4,4,6,6-tetramethylcyclohexene-1-carboxylate. InChIKey: CZRDPCJDOIYDRY-UHFFFAOYSA-N.
| Molecular formula | C12H20O2 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | methyl 4,4,6,6-tetramethylcyclohexene-1-carboxylate |
| InChIKey | CZRDPCJDOIYDRY-UHFFFAOYSA-N |
| SMILES | CC1(CC=C(C(C1)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)