Products 2234308-25-7

CAS 2234308-25-7 is the registry number for Rubber Oligomer 8. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4,4,6,6-tetramethylcyclohexene-1-carboxylate (CAS 2234308-25-7) is a chemical compound with the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. IUPAC name: methyl 4,4,6,6-tetramethylcyclohexene-1-carboxylate. InChIKey: CZRDPCJDOIYDRY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O2
Molecular weight196.29 g/mol
IUPAC namemethyl 4,4,6,6-tetramethylcyclohexene-1-carboxylate
InChIKeyCZRDPCJDOIYDRY-UHFFFAOYSA-N
SMILESCC1(CC=C(C(C1)(C)C)C(=O)OC)C

Computed by PubChem (NCBI)