Products 2783-57-5

CAS 2783-57-5 appears in our catalog under these names: Omeprazole Impurity 67, Omeprazole Impurity 35, Iodoquinol Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-aminocyclohexa-2,5-diene-1,4-dione (CAS 2783-57-5) is a chemical compound with the molecular formula C6H5NO2 and a molecular weight of 123.11 g/mol. IUPAC name: 2-aminocyclohexa-2,5-diene-1,4-dione. InChIKey: IHXKXSJKLJZXKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO2
Molecular weight123.11 g/mol
IUPAC name2-aminocyclohexa-2,5-diene-1,4-dione
InChIKeyIHXKXSJKLJZXKZ-UHFFFAOYSA-N
SMILESC1=CC(=O)C(=CC1=O)N

Computed by PubChem (NCBI)