Products 223487-44-3
CAS 223487-44-3 appears in our catalog under these names: Oleic Acid-d17 (5 mg/mL in Methyl acetate), >95% (GC), Oleic Acid–d17, Oleic acid-d17, 99.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 500 μg (3.34 mM * 500 μL in Methyl acetate).
(Z)-11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-heptadecadeuteriooctadec-9-enoic acid (CAS 223487-44-3) is a chemical compound with the molecular formula C18H34O2 and a molecular weight of 299.6 g/mol. IUPAC name: (Z)-11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-heptadecadeuteriooctadec-9-enoic acid. InChIKey: ZQPPMHVWECSIRJ-DUGYPAGXSA-N.
| Molecular formula | C18H34O2 |
|---|---|
| Molecular weight | 299.6 g/mol |
| IUPAC name | (Z)-11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-heptadecadeuteriooctadec-9-enoic acid |
| InChIKey | ZQPPMHVWECSIRJ-DUGYPAGXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])/C=C\CCCCCCCC(=O)O |
Computed by PubChem (NCBI)