Products 2483735-58-4

CAS 2483735-58-4 is the registry number for Oleic acid-13C-1, 99.9%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

(Z)-(1813C)octadec-9-enoic acid (CAS 2483735-58-4) is a chemical compound with the molecular formula C18H34O2 and a molecular weight of 283.5 g/mol. IUPAC name: (Z)-(1813C)octadec-9-enoic acid. InChIKey: ZQPPMHVWECSIRJ-HWHZINPGSA-N.

Identity
Molecular formulaC18H34O2
Molecular weight283.5 g/mol
IUPAC name(Z)-(1813C)octadec-9-enoic acid
InChIKeyZQPPMHVWECSIRJ-HWHZINPGSA-N
SMILES[13CH3]CCCCCCC/C=C\CCCCCCCC(=O)O

Computed by PubChem (NCBI)