CAS 223568-55-6 appears in our catalog under these names: Z-Val-dl-asp-fluoromethylketone, 95%, EP1013 (F1013), Z-Val-dl-asp-fluoromethylketone, EP1013. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 1mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg.
(3S)-5-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4-oxopentanoic acid (CAS 223568-55-6) is a chemical compound with the molecular formula C18H23FN2O6 and a molecular weight of 382.4 g/mol. IUPAC name: (3S)-5-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4-oxopentanoic acid. InChIKey: LYBWGROBJJXCJJ-BBRMVZONSA-N.
| Molecular formula | C18H23FN2O6 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | (3S)-5-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4-oxopentanoic acid |
| InChIKey | LYBWGROBJJXCJJ-BBRMVZONSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)CF)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)