CAS 582316-00-5 appears in our catalog under these names: MX1013, 3-((S)-2-(((Benzyloxy)carbonyl)amino)-3-methylbutanamido)-5-fluoro-4-oxopentanoic acid, 96.32%, 96.32%, MX1013, 99.0%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 100 mg.
5-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4-oxopentanoic acid (CAS 582316-00-5) is a chemical compound with the molecular formula C18H23FN2O6 and a molecular weight of 382.4 g/mol. IUPAC name: 5-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4-oxopentanoic acid. InChIKey: LYBWGROBJJXCJJ-VYIIXAMBSA-N.
| Molecular formula | C18H23FN2O6 |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | 5-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4-oxopentanoic acid |
| InChIKey | LYBWGROBJJXCJJ-VYIIXAMBSA-N |
| SMILES | CC(C)[C@@H](C(=O)NC(CC(=O)O)C(=O)CF)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)