CAS 223581-75-7 appears in our catalog under these names: Fmoc-L-Phe(3-NH2)-OH 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-aminophenyl)propanoic acid, 95%, 95%, Fmoc-L-Phe(3-NH2)-OH, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2S)-3-(3-aminophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 223581-75-7) is a chemical compound with the molecular formula C24H22N2O4 and a molecular weight of 402.4 g/mol. IUPAC name: (2S)-3-(3-aminophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZNJZSLBSDBNOSV-QFIPXVFZSA-N.
| Molecular formula | C24H22N2O4 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (2S)-3-(3-aminophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZNJZSLBSDBNOSV-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)N)C(=O)O |
Computed by PubChem (NCBI)