CAS 223581-98-4 appears in our catalog under these names: Fmoc-5-cyano-L-tryptophan, ≥98%, ≥98%, Fmoc-L-Trp(5-CN)-OH, Fmoc-L-Trp(5-CN)-OH 95%. Offered by: Chemat, Iris Biotech, Ambeed. Available pack sizes: 500mg, 1g, 250mg, 100mg.
(2S)-3-(5-cyano-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 223581-98-4) is a chemical compound with the molecular formula C27H21N3O4 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-3-(5-cyano-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CDZLLUUXBGXERH-VWLOTQADSA-N.
| Molecular formula | C27H21N3O4 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-3-(5-cyano-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CDZLLUUXBGXERH-VWLOTQADSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C=C(C=C5)C#N)C(=O)O |
Computed by PubChem (NCBI)