CAS 2435665-77-1 is the registry number for Fmoc-L-Trp(4-CN)-OH. Offered by: Iris Biotech. Available pack sizes: 100mg, 1g.
(2S)-3-(4-cyano-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2435665-77-1) is a chemical compound with the molecular formula C27H21N3O4 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-3-(4-cyano-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: OAGILXPLRNQHGT-DEOSSOPVSA-N.
| Molecular formula | C27H21N3O4 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-3-(4-cyano-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | OAGILXPLRNQHGT-DEOSSOPVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=CC=CC(=C54)C#N)C(=O)O |
Computed by PubChem (NCBI)