Products 223673-36-7
CAS 223673-36-7 appears in our catalog under these names: (R)-tert-Butyl 4-aminophenethyl(2-hydroxy-2-phenylethyl)carbamate, 95%, (R)–tert–Butyl 4–aminophenethyl(2–hydroxy–2–phenylethyl)carbamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
Tert-butyl N-[2-(4-aminophenyl)ethyl]-N-[(2R)-2-hydroxy-2-phenylethyl]carbamate (CAS 223673-36-7) is a chemical compound with the molecular formula C21H28N2O3 and a molecular weight of 356.5 g/mol. IUPAC name: tert-butyl N-[2-(4-aminophenyl)ethyl]-N-[(2R)-2-hydroxy-2-phenylethyl]carbamate. InChIKey: CBVMLUHTBIZQRL-IBGZPJMESA-N.
| Molecular formula | C21H28N2O3 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | tert-butyl N-[2-(4-aminophenyl)ethyl]-N-[(2R)-2-hydroxy-2-phenylethyl]carbamate |
| InChIKey | CBVMLUHTBIZQRL-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N(CCC1=CC=C(C=C1)N)C[C@@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)