Products 2714570-98-4
CAS 2714570-98-4 is the registry number for Monoacylglycerol lipase inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-methyl-6-oxo-N-[3-(4-propan-2-ylphenyl)cyclobutyl]-7-oxa-5-azaspiro[3.4]octane-2-carboxamide (CAS 2714570-98-4) is a chemical compound with the molecular formula C21H28N2O3 and a molecular weight of 356.5 g/mol. IUPAC name: N-methyl-6-oxo-N-[3-(4-propan-2-ylphenyl)cyclobutyl]-7-oxa-5-azaspiro[3.4]octane-2-carboxamide. InChIKey: BKAUVVYBHJYFLY-UHFFFAOYSA-N.
| Molecular formula | C21H28N2O3 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | N-methyl-6-oxo-N-[3-(4-propan-2-ylphenyl)cyclobutyl]-7-oxa-5-azaspiro[3.4]octane-2-carboxamide |
| InChIKey | BKAUVVYBHJYFLY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2CC(C2)N(C)C(=O)C3CC4(C3)COC(=O)N4 |
Computed by PubChem (NCBI)