CAS 2237235-34-4 appears in our catalog under these names: 2,4-Difluoro-3-(trifluoromethoxy)phenylacetylene, 95%, 2,4-Difluoro-3-(trifluoromethoxy)phenylacetylene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-ethynyl-2,4-difluoro-3-(trifluoromethoxy)benzene (CAS 2237235-34-4) is a chemical compound with the molecular formula C9H3F5O and a molecular weight of 222.11 g/mol. IUPAC name: 1-ethynyl-2,4-difluoro-3-(trifluoromethoxy)benzene. InChIKey: DAIZTTAVVQJUQC-UHFFFAOYSA-N.
| Molecular formula | C9H3F5O |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 1-ethynyl-2,4-difluoro-3-(trifluoromethoxy)benzene |
| InChIKey | DAIZTTAVVQJUQC-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C(=C(C=C1)F)OC(F)(F)F)F |
Computed by PubChem (NCBI)