CAS 2416308-29-5 is the registry number for 2,2,3,3,6-Pentafluoro-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,3,3,6-pentafluoroinden-1-one (CAS 2416308-29-5) is a chemical compound with the molecular formula C9H3F5O and a molecular weight of 222.11 g/mol. IUPAC name: 2,2,3,3,6-pentafluoroinden-1-one. InChIKey: QMAKJXQSBLDSJW-UHFFFAOYSA-N.
| Molecular formula | C9H3F5O |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 2,2,3,3,6-pentafluoroinden-1-one |
| InChIKey | QMAKJXQSBLDSJW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)C(C2(F)F)(F)F |
Computed by PubChem (NCBI)