CAS 22384-58-3 appears in our catalog under these names: 3-(5-Bromo-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)propanoic acid, 95%, 3-(5-Bromo-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(5-bromo-2,4-dioxopyrimidin-1-yl)propanoic acid (CAS 22384-58-3) is a chemical compound with the molecular formula C7H7BrN2O4 and a molecular weight of 263.05 g/mol. IUPAC name: 3-(5-bromo-2,4-dioxopyrimidin-1-yl)propanoic acid. InChIKey: QPUZMEJUORRXBG-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O4 |
|---|---|
| Molecular weight | 263.05 g/mol |
| IUPAC name | 3-(5-bromo-2,4-dioxopyrimidin-1-yl)propanoic acid |
| InChIKey | QPUZMEJUORRXBG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1CCC(=O)O)Br |
Computed by PubChem (NCBI)