CAS 79491-48-8 is the registry number for 2-Bromo-5,6-dimethoxy-3-nitropyridine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromo-5,6-dimethoxy-3-nitropyridine (CAS 79491-48-8) is a chemical compound with the molecular formula C7H7BrN2O4 and a molecular weight of 263.05 g/mol. IUPAC name: 2-bromo-5,6-dimethoxy-3-nitropyridine. InChIKey: FVBNYAYTCCNKSG-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O4 |
|---|---|
| Molecular weight | 263.05 g/mol |
| IUPAC name | 2-bromo-5,6-dimethoxy-3-nitropyridine |
| InChIKey | FVBNYAYTCCNKSG-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C(=C1)[N+](=O)[O-])Br)OC |
Computed by PubChem (NCBI)