Products 22389-85-1
CAS 22389-85-1 appears in our catalog under these names: 2–Methylpyrido(3，4–d)pyrimidin–4(1H)–one, Pyrido(3,4-d)pyrimidin-4(1H)-one, 2-methyl-, 2-Methylpyrido[3,4-d]pyrimidin-4(1H)-one, 97%, 97%, 2-Methylpyrido[3,4-d]pyrimidin-4-ol, 97%, 2-Methylpyrido[3,4-d]pyrimidin-4(3H)-one, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 100mg, 5g.
2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one (CAS 22389-85-1) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one. InChIKey: ZZGGQKRBGZEHKC-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one |
| InChIKey | ZZGGQKRBGZEHKC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CN=C2)C(=O)N1 |
Computed by PubChem (NCBI)