CAS 223906-38-5 appears in our catalog under these names: (R)-4-Isopropyl-5,5-dimethyloxazolidin-2-one, 98%, (R)-(+)-4-ISOPROPYL-5,5-DIMETHYL-2- &. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 250MG.
(4R)-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one (CAS 223906-38-5) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (4R)-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one. InChIKey: QICFUFOXXNIZFF-ZCFIWIBFSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | (4R)-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| InChIKey | QICFUFOXXNIZFF-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@@H]1C(OC(=O)N1)(C)C |
Computed by PubChem (NCBI)