CAS 224040-86-2 appears in our catalog under these names: 1–(Naphthalen–2–yl)–2–(pyridin–4–yl)ethanone, 1-(Naphthalen-2-yl)-2-(pyridin-4-yl)ethan-1-one, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
1-naphthalen-2-yl-2-pyridin-4-ylethanone (CAS 224040-86-2) is a chemical compound with the molecular formula C17H13NO and a molecular weight of 247.29 g/mol. IUPAC name: 1-naphthalen-2-yl-2-pyridin-4-ylethanone. InChIKey: FPYXFESVUPAJGD-UHFFFAOYSA-N.
| Molecular formula | C17H13NO |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 1-naphthalen-2-yl-2-pyridin-4-ylethanone |
| InChIKey | FPYXFESVUPAJGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CC3=CC=NC=C3 |
Computed by PubChem (NCBI)