CAS 2241130-16-3 is the registry number for (4-Chloro-2-methoxyphenyl)(phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-chloro-2-methoxyphenyl)-phenylmethanamine;hydrochloride (CAS 2241130-16-3) is a chemical compound with the molecular formula C14H15Cl2NO and a molecular weight of 284.2 g/mol. IUPAC name: (4-chloro-2-methoxyphenyl)-phenylmethanamine;hydrochloride. InChIKey: OVIXWTYMQUMOPE-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2NO |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | (4-chloro-2-methoxyphenyl)-phenylmethanamine;hydrochloride |
| InChIKey | OVIXWTYMQUMOPE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)