CAS 362593-33-7 is the registry number for 3-[(3,4-Dichlorophenyl)amino]-5,5-dimethylcyclohex-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3,4-dichloroanilino)-5,5-dimethylcyclohex-2-en-1-one (CAS 362593-33-7) is a chemical compound with the molecular formula C14H15Cl2NO and a molecular weight of 284.2 g/mol. IUPAC name: 3-(3,4-dichloroanilino)-5,5-dimethylcyclohex-2-en-1-one. InChIKey: XAILJFZUDSJXMF-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2NO |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | 3-(3,4-dichloroanilino)-5,5-dimethylcyclohex-2-en-1-one |
| InChIKey | XAILJFZUDSJXMF-UHFFFAOYSA-N |
| SMILES | CC1(CC(=CC(=O)C1)NC2=CC(=C(C=C2)Cl)Cl)C |
Computed by PubChem (NCBI)