Products 2241141-24-0
CAS 2241141-24-0 is the registry number for 4,6-Dimethylthieno(3,4-b)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,6-dimethylthieno[2,3-c]thiophene-2-carboxylic acid (CAS 2241141-24-0) is a chemical compound with the molecular formula C9H8O2S2 and a molecular weight of 212.3 g/mol. IUPAC name: 4,6-dimethylthieno[2,3-c]thiophene-2-carboxylic acid. InChIKey: LHHDPBDSCYVCTP-UHFFFAOYSA-N.
| Molecular formula | C9H8O2S2 |
|---|---|
| Molecular weight | 212.3 g/mol |
| IUPAC name | 4,6-dimethylthieno[2,3-c]thiophene-2-carboxylic acid |
| InChIKey | LHHDPBDSCYVCTP-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(SC2=C(S1)C)C(=O)O |
Computed by PubChem (NCBI)