Products 85504-38-7
CAS 85504-38-7 is the registry number for 2-{5-Methylthieno(2,3-b)thiophen-3-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-methylthieno[2,3-b]thiophen-3-yl)acetic acid (CAS 85504-38-7) is a chemical compound with the molecular formula C9H8O2S2 and a molecular weight of 212.3 g/mol. IUPAC name: 2-(5-methylthieno[2,3-b]thiophen-3-yl)acetic acid. InChIKey: AZNSEOCMXZFVFA-UHFFFAOYSA-N.
| Molecular formula | C9H8O2S2 |
|---|---|
| Molecular weight | 212.3 g/mol |
| IUPAC name | 2-(5-methylthieno[2,3-b]thiophen-3-yl)acetic acid |
| InChIKey | AZNSEOCMXZFVFA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)SC=C2CC(=O)O |
Computed by PubChem (NCBI)