Products 2241142-56-1
CAS 2241142-56-1 is the registry number for (1-(2,4-Difluorophenyl)but-3-yn-2-yl)(methyl)amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2,4-difluorophenyl)-N-methylbut-3-yn-2-amine;hydrochloride (CAS 2241142-56-1) is a chemical compound with the molecular formula C11H12ClF2N and a molecular weight of 231.67 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-N-methylbut-3-yn-2-amine;hydrochloride. InChIKey: GYCIPFZOLYCZMY-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF2N |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-N-methylbut-3-yn-2-amine;hydrochloride |
| InChIKey | GYCIPFZOLYCZMY-UHFFFAOYSA-N |
| SMILES | CNC(CC1=C(C=C(C=C1)F)F)C#C.Cl |
Computed by PubChem (NCBI)