CAS 2375269-28-4 is the registry number for 2,2-Difluoro-3-phenylbicyclo(1.1.1)pentan-1-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2,2-difluoro-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 2375269-28-4) is a chemical compound with the molecular formula C11H12ClF2N and a molecular weight of 231.67 g/mol. IUPAC name: 2,2-difluoro-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: XWQZAEAVYSRFGO-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF2N |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 2,2-difluoro-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | XWQZAEAVYSRFGO-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2(F)F)N)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)