CAS 2241432-81-3 is the registry number for 2–Chloro–8–fluoro–5H–dibenzo(b,e)(1,4)diazepin–11(10H)–one. Offered by: GLPBio. Available pack sizes: 50mg.
8-chloro-3-fluoro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (CAS 2241432-81-3) is a chemical compound with the molecular formula C13H8ClFN2O and a molecular weight of 262.66 g/mol. IUPAC name: 8-chloro-3-fluoro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one. InChIKey: MDOXRMDDOSYFGS-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFN2O |
|---|---|
| Molecular weight | 262.66 g/mol |
| IUPAC name | 8-chloro-3-fluoro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| InChIKey | MDOXRMDDOSYFGS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)