CAS 313527-40-1 is the registry number for 2-(2-Chloro-4-fluorophenyl)benzo[d]oxazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-amine (CAS 313527-40-1) is a chemical compound with the molecular formula C13H8ClFN2O and a molecular weight of 262.66 g/mol. IUPAC name: 2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-amine. InChIKey: BQKPWIUOACSHEA-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFN2O |
|---|---|
| Molecular weight | 262.66 g/mol |
| IUPAC name | 2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | BQKPWIUOACSHEA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)N=C(O2)C3=C(C=C(C=C3)F)Cl |
Computed by PubChem (NCBI)