Products 2241588-81-6
CAS 2241588-81-6 appears in our catalog under these names: Methyl 2-(dibromomethyl)-6-nitrobenzoate, 97%, 2-Dibromomethyl-6-nitro-benzoic acid methyl ester, 95%, 2-Dibromomethyl-6-nitro-benzoic acid methyl ester, 97%, 97%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100mg.
Methyl 2-(dibromomethyl)-6-nitrobenzoate (CAS 2241588-81-6) is a chemical compound with the molecular formula C9H7Br2NO4 and a molecular weight of 352.96 g/mol. IUPAC name: methyl 2-(dibromomethyl)-6-nitrobenzoate. InChIKey: NPEIYSBHBFHZAD-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2NO4 |
|---|---|
| Molecular weight | 352.96 g/mol |
| IUPAC name | methyl 2-(dibromomethyl)-6-nitrobenzoate |
| InChIKey | NPEIYSBHBFHZAD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1[N+](=O)[O-])C(Br)Br |
Computed by PubChem (NCBI)