Products 35447-78-0

CAS 35447-78-0 is the registry number for 2,3-Dibromo-3-(4-nitrophenyl)propanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2,3-dibromo-3-(4-nitrophenyl)propanoic acid (CAS 35447-78-0) is a chemical compound with the molecular formula C9H7Br2NO4 and a molecular weight of 352.96 g/mol. IUPAC name: 2,3-dibromo-3-(4-nitrophenyl)propanoic acid. InChIKey: FZSNEPIHJADWSK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7Br2NO4
Molecular weight352.96 g/mol
IUPAC name2,3-dibromo-3-(4-nitrophenyl)propanoic acid
InChIKeyFZSNEPIHJADWSK-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(C(C(=O)O)Br)Br)[N+](=O)[O-]

Computed by PubChem (NCBI)