CAS 35447-78-0 is the registry number for 2,3-Dibromo-3-(4-nitrophenyl)propanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dibromo-3-(4-nitrophenyl)propanoic acid (CAS 35447-78-0) is a chemical compound with the molecular formula C9H7Br2NO4 and a molecular weight of 352.96 g/mol. IUPAC name: 2,3-dibromo-3-(4-nitrophenyl)propanoic acid. InChIKey: FZSNEPIHJADWSK-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2NO4 |
|---|---|
| Molecular weight | 352.96 g/mol |
| IUPAC name | 2,3-dibromo-3-(4-nitrophenyl)propanoic acid |
| InChIKey | FZSNEPIHJADWSK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(C(=O)O)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)