CAS 2241594-12-5 appears in our catalog under these names: (R)-1-(5-Bromofuran-2-yl)ethan-1-amine hydrochloride, 95%, (R)–1–(5–Bromofuran–2–yl)ethanamine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(5-bromofuran-2-yl)ethanamine;hydrochloride (CAS 2241594-12-5) is a chemical compound with the molecular formula C6H9BrClNO and a molecular weight of 226.50 g/mol. IUPAC name: (1R)-1-(5-bromofuran-2-yl)ethanamine;hydrochloride. InChIKey: FKRYJPPQTPWPHV-PGMHMLKASA-N.
| Molecular formula | C6H9BrClNO |
|---|---|
| Molecular weight | 226.50 g/mol |
| IUPAC name | (1R)-1-(5-bromofuran-2-yl)ethanamine;hydrochloride |
| InChIKey | FKRYJPPQTPWPHV-PGMHMLKASA-N |
| SMILES | C[C@H](C1=CC=C(O1)Br)N.Cl |
Computed by PubChem (NCBI)