CAS 2241594-47-6 is the registry number for (S)–1–(5–Bromofuran–2–yl)ethanamine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(1S)-1-(5-bromofuran-2-yl)ethanamine;hydrochloride (CAS 2241594-47-6) is a chemical compound with the molecular formula C6H9BrClNO and a molecular weight of 226.50 g/mol. IUPAC name: (1S)-1-(5-bromofuran-2-yl)ethanamine;hydrochloride. InChIKey: FKRYJPPQTPWPHV-WCCKRBBISA-N.
| Molecular formula | C6H9BrClNO |
|---|---|
| Molecular weight | 226.50 g/mol |
| IUPAC name | (1S)-1-(5-bromofuran-2-yl)ethanamine;hydrochloride |
| InChIKey | FKRYJPPQTPWPHV-WCCKRBBISA-N |
| SMILES | C[C@@H](C1=CC=C(O1)Br)N.Cl |
Computed by PubChem (NCBI)