CAS 2241865-87-0 is the registry number for (4–(methyl–d3)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 5mg.
[4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid (CAS 2241865-87-0) is a chemical compound with the molecular formula C5H7BN2O2 and a molecular weight of 140.95 g/mol. IUPAC name: [4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid. InChIKey: JEZGDIQZAMOHQF-FIBGUPNXSA-N.
| Molecular formula | C5H7BN2O2 |
|---|---|
| Molecular weight | 140.95 g/mol |
| IUPAC name | [4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid |
| InChIKey | JEZGDIQZAMOHQF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=NC=C1B(O)O |
Computed by PubChem (NCBI)