Products 1034924-06-5

CAS 1034924-06-5 appears in our catalog under these names: (2-Methylpyrimidin-5-yl)boronic acid 96%, 2-Methylpyrimidine-5-boronic Acid, 97%, 97%, (2-Methylpyrimidin-5-yl)boronic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

(2-methylpyrimidin-5-yl)boronic acid (CAS 1034924-06-5) is a chemical compound with the molecular formula C5H7BN2O2 and a molecular weight of 137.93 g/mol. IUPAC name: (2-methylpyrimidin-5-yl)boronic acid. InChIKey: BTJLWJOEZRVRNL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7BN2O2
Molecular weight137.93 g/mol
IUPAC name(2-methylpyrimidin-5-yl)boronic acid
InChIKeyBTJLWJOEZRVRNL-UHFFFAOYSA-N
SMILESB(C1=CN=C(N=C1)C)(O)O

Computed by PubChem (NCBI)