Products 2241874-63-3

CAS 2241874-63-3 is the registry number for 2',3'-Diamino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2,3-diamino-4-(4-carboxyphenyl)phenyl]benzoic acid (CAS 2241874-63-3) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: 4-[2,3-diamino-4-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: LSMMCFNRBAVFFO-UHFFFAOYSA-N.

Identity
Molecular formulaC20H16N2O4
Molecular weight348.4 g/mol
IUPAC name4-[2,3-diamino-4-(4-carboxyphenyl)phenyl]benzoic acid
InChIKeyLSMMCFNRBAVFFO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C(C(=C(C=C2)C3=CC=C(C=C3)C(=O)O)N)N)C(=O)O

Computed by PubChem (NCBI)