CAS 2241874-63-3 is the registry number for 2',3'-Diamino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2,3-diamino-4-(4-carboxyphenyl)phenyl]benzoic acid (CAS 2241874-63-3) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: 4-[2,3-diamino-4-(4-carboxyphenyl)phenyl]benzoic acid. InChIKey: LSMMCFNRBAVFFO-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 4-[2,3-diamino-4-(4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | LSMMCFNRBAVFFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=C(C=C2)C3=CC=C(C=C3)C(=O)O)N)N)C(=O)O |
Computed by PubChem (NCBI)