Products 16926-73-1
CAS 16926-73-1 appears in our catalog under these names: Bis(4-aminophenyl) terephthalate, 95%, Bis(4–aminophenyl) terephthalate, Bis(4-aminophenyl) Terephthalate, >98.0%(HPLC), Bis(4-aminophenyl) terephthalate, 97%. Offered by: Combi-blocks, GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 100mg.
Bis(4-aminophenyl) benzene-1,4-dicarboxylate (CAS 16926-73-1) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: bis(4-aminophenyl) benzene-1,4-dicarboxylate. InChIKey: CFTXGNJIXHFHTH-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | bis(4-aminophenyl) benzene-1,4-dicarboxylate |
| InChIKey | CFTXGNJIXHFHTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)N)C(=O)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)
Synonyms:
1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester, Bis(4-aminophenyl) benzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid, bis(4-aminophenyl) ester, Bis(4-aminophenyl)terephthalate, 1,4-Benzenedicarboxylic acid bis(4-aminophenyl) ester pound BAPT pound(c), Bis(4-aminoph, 1,4-bis(4-aminophenyl) benzene-1,4-dicarboxylate, CFTXGNJIXHFHTH-UHFFFAOYSA-N