Products 10109-95-2
CAS 10109-95-2 appears in our catalog under these names: 2,5–Bis(phenylamino)terephthalic acid, 2,5-Bis(phenylamino)terephthalic acid, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2,5-dianilinoterephthalic acid (CAS 10109-95-2) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: 2,5-dianilinoterephthalic acid. InChIKey: ZJQZWNLKRBUEKX-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2,5-dianilinoterephthalic acid |
| InChIKey | ZJQZWNLKRBUEKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=C(C=C2C(=O)O)NC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,5-Dianilinoterephthalic acid, 1,4-Benzenedicarboxylic acid, 2,5-bis(phenylamino)-, 2,5-bis(phenylamino)terephthalic acid, 2,5-di(phenylamino)terephthalic acid, CBDivE_010595, 2,5-bis(phenylamino)-4-benzenedicarboxylicacid, 2,5-Dianilinoterephthalsure, Oprea1_567229, Oprea1_594854, 2,5dianilinoterephthalic acid