CAS 2241875-90-9 is the registry number for (2–(ethoxy–d5)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-(1,1,2,2,2-pentadeuterioethoxy)-4-pyridinyl]boronic acid (CAS 2241875-90-9) is a chemical compound with the molecular formula C7H10BNO3 and a molecular weight of 172.00 g/mol. IUPAC name: [2-(1,1,2,2,2-pentadeuterioethoxy)-4-pyridinyl]boronic acid. InChIKey: ZQABQGHEJQIWFW-ZBJDZAJPSA-N.
| Molecular formula | C7H10BNO3 |
|---|---|
| Molecular weight | 172.00 g/mol |
| IUPAC name | [2-(1,1,2,2,2-pentadeuterioethoxy)-4-pyridinyl]boronic acid |
| InChIKey | ZQABQGHEJQIWFW-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=NC=CC(=C1)B(O)O |
Computed by PubChem (NCBI)