Products 2241876-06-0
CAS 2241876-06-0 is the registry number for (6–(methoxy–d3)–5–(methyl–d3)pyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[6-(trideuteriomethoxy)-5-(trideuteriomethyl)-3-pyridinyl]boronic acid (CAS 2241876-06-0) is a chemical compound with the molecular formula C7H10BNO3 and a molecular weight of 173.01 g/mol. IUPAC name: [6-(trideuteriomethoxy)-5-(trideuteriomethyl)-3-pyridinyl]boronic acid. InChIKey: QXCAEPGEVCYRJO-WFGJKAKNSA-N.
| Molecular formula | C7H10BNO3 |
|---|---|
| Molecular weight | 173.01 g/mol |
| IUPAC name | [6-(trideuteriomethoxy)-5-(trideuteriomethyl)-3-pyridinyl]boronic acid |
| InChIKey | QXCAEPGEVCYRJO-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(N=CC(=C1)B(O)O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)