CAS 2241982-86-3 is the registry number for 3-(Phenyl-2-d)propanenitrile-2,2-d2, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2,2-dideuterio-3-(2-deuteriophenyl)propanenitrile (CAS 2241982-86-3) is a chemical compound with the molecular formula C9H9N and a molecular weight of 134.19 g/mol. IUPAC name: 2,2-dideuterio-3-(2-deuteriophenyl)propanenitrile. InChIKey: ACRWYXSKEHUQDB-AFBAWBIXSA-N.
| Molecular formula | C9H9N |
|---|---|
| Molecular weight | 134.19 g/mol |
| IUPAC name | 2,2-dideuterio-3-(2-deuteriophenyl)propanenitrile |
| InChIKey | ACRWYXSKEHUQDB-AFBAWBIXSA-N |
| SMILES | [2H]C1=C(C=CC=C1)CC([2H])([2H])C#N |
Computed by PubChem (NCBI)