Products 22424-61-9
CAS 22424-61-9 is the registry number for alpha-Oxo-5-(phenylmethoxy)-1H-indole-3-acetyl Chloride. Offered by: TRC. Available pack sizes: 25mg.
2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetyl chloride (CAS 22424-61-9) is a chemical compound with the molecular formula C17H12ClNO3 and a molecular weight of 313.7 g/mol. IUPAC name: 2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetyl chloride. InChIKey: XLZYMUNRALGNSP-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO3 |
|---|---|
| Molecular weight | 313.7 g/mol |
| IUPAC name | 2-oxo-2-(5-phenylmethoxy-1H-indol-3-yl)acetyl chloride |
| InChIKey | XLZYMUNRALGNSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3C(=O)C(=O)Cl |
Computed by PubChem (NCBI)