Products 410086-58-7
CAS 410086-58-7 is the registry number for 5-(3-Chloro-1-oxoisoquinolin-2(1H)-yl)-2-methoxybenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3-chloro-1-oxoisoquinolin-2-yl)-2-methoxybenzaldehyde (CAS 410086-58-7) is a chemical compound with the molecular formula C17H12ClNO3 and a molecular weight of 313.7 g/mol. IUPAC name: 5-(3-chloro-1-oxoisoquinolin-2-yl)-2-methoxybenzaldehyde. InChIKey: WONLCFBWMPZDID-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO3 |
|---|---|
| Molecular weight | 313.7 g/mol |
| IUPAC name | 5-(3-chloro-1-oxoisoquinolin-2-yl)-2-methoxybenzaldehyde |
| InChIKey | WONLCFBWMPZDID-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2C(=CC3=CC=CC=C3C2=O)Cl)C=O |
Computed by PubChem (NCBI)